EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O12 |
| Net Charge | 0 |
| Average Mass | 578.526 |
| Monoisotopic Mass | 578.14243 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28+,29+/m0/s1 |
| InChIKey | XFZJEEAOWLFHDH-AVFWISQGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 2.3.1.48 (histone acetyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the function of histone acetyltransferase (EC 2.3.1.48). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin B3 (CHEBI:75630) has functional parent (+)-catechin (CHEBI:15600) |
| procyanidin B3 (CHEBI:75630) has role anti-inflammatory agent (CHEBI:67079) |
| procyanidin B3 (CHEBI:75630) has role antioxidant (CHEBI:22586) |
| procyanidin B3 (CHEBI:75630) has role EC 2.3.1.48 (histone acetyltransferase) inhibitor (CHEBI:76395) |
| procyanidin B3 (CHEBI:75630) has role metabolite (CHEBI:25212) |
| procyanidin B3 (CHEBI:75630) is a biflavonoid (CHEBI:50128) |
| procyanidin B3 (CHEBI:75630) is a hydroxyflavan (CHEBI:72010) |
| procyanidin B3 (CHEBI:75630) is a polyphenol (CHEBI:26195) |
| procyanidin B3 (CHEBI:75630) is a proanthocyanidin (CHEBI:26267) |
| Incoming Relation(s) |
| procyanidin B3 3-O-gallate (CHEBI:75656) has functional parent procyanidin B3 (CHEBI:75630) |
| procyanidin B3 3'-O-gallate (CHEBI:75662) has functional parent procyanidin B3 (CHEBI:75630) |
| IUPAC Name |
|---|
| (2R,2'R,3S,3'S,4S)-2,2'-bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5,5',7,7'-hexol |
| Synonyms | Source |
|---|---|
| C-(4a,8)-C | HMDB |
| Catechin(4a→8)catechin | HMDB |
| Catechin-(4α→8)-catechin | HMDB |
| Proanthocyanidin B3 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C10209 | KEGG COMPOUND |
| HMDB0033974 | HMDB |
| KR20100129858 | Patent |
| LMPK12030003 | LIPID MAPS |
| Procyanidin_B3 | Wikipedia |
| WO2010021935 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3586582 | Reaxys |
| CAS:23567-23-9 | ChemIDplus |
| Citations |
|---|