EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O12 |
| Net Charge | 0 |
| Average Mass | 578.526 |
| Monoisotopic Mass | 578.14243 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28+,29+/m0/s1 |
| InChIKey | XFZJEEAOWLFHDH-AVFWISQGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.3.1.48 (histone acetyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the function of histone acetyltransferase (EC 2.3.1.48). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin B3 (CHEBI:75630) has functional parent (+)-catechin (CHEBI:15600) |
| procyanidin B3 (CHEBI:75630) has role anti-inflammatory agent (CHEBI:67079) |
| procyanidin B3 (CHEBI:75630) has role antioxidant (CHEBI:22586) |
| procyanidin B3 (CHEBI:75630) has role EC 2.3.1.48 (histone acetyltransferase) inhibitor (CHEBI:76395) |
| procyanidin B3 (CHEBI:75630) has role metabolite (CHEBI:25212) |
| procyanidin B3 (CHEBI:75630) is a biflavonoid (CHEBI:50128) |
| procyanidin B3 (CHEBI:75630) is a hydroxyflavan (CHEBI:72010) |
| procyanidin B3 (CHEBI:75630) is a polyphenol (CHEBI:26195) |
| procyanidin B3 (CHEBI:75630) is a proanthocyanidin (CHEBI:26267) |
| Incoming Relation(s) |
| procyanidin B3 3-O-gallate (CHEBI:75656) has functional parent procyanidin B3 (CHEBI:75630) |
| procyanidin B3 3'-O-gallate (CHEBI:75662) has functional parent procyanidin B3 (CHEBI:75630) |
| IUPAC Name |
|---|
| (2R,2'R,3S,3'S,4S)-2,2'-bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5,5',7,7'-hexol |
| Synonyms | Source |
|---|---|
| Catechin-(4α→8)-catechin | HMDB |
| Proanthocyanidin B3 | HMDB |
| Catechin(4a→8)catechin | HMDB |
| C-(4a,8)-C | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033974 | HMDB |
| Procyanidin_B3 | Wikipedia |
| LMPK12030003 | LIPID MAPS |
| C10209 | KEGG COMPOUND |
| KR20100129858 | Patent |
| WO2010021935 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3586582 | Reaxys |
| CAS:23567-23-9 | ChemIDplus |
| Citations |
|---|