EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H30O16 |
| Net Charge | 0 |
| Average Mass | 730.631 |
| Monoisotopic Mass | 730.15338 |
| SMILES | O=C(O[C@H]1Cc2c(O)cc(O)c([C@H]3c4c(O)cc(O)cc4O[C@H](c4ccc(O)c(O)c4)[C@@H]3O)c2O[C@@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C37H30O16/c38-16-9-23(44)29-27(10-16)51-35(14-2-4-19(40)22(43)6-14)33(49)31(29)30-24(45)12-20(41)17-11-28(52-37(50)15-7-25(46)32(48)26(47)8-15)34(53-36(17)30)13-1-3-18(39)21(42)5-13/h1-10,12,28,31,33-35,38-49H,11H2/t28-,31+,33+,34+,35+/m0/s1 |
| InChIKey | VLFKNLZNDSEVBZ-XOKZLUOPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) has functional parent gallic acid (CHEBI:30778) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) has functional parent procyanidin B1 (CHEBI:75633) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) has role metabolite (CHEBI:25212) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) is a biflavonoid (CHEBI:50128) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) is a gallate ester (CHEBI:37576) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) is a polyphenol (CHEBI:26195) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,2'R,3R,3'S,4R)-2,2'-bis(3,4-dihydroxyphenyl)-3,5,5',7,7'-pentahydroxy-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromen-3'-yl 3,4,5-trihydroxybenzoate |
| Synonym | Source |
|---|---|
| (−)-epicatechin-(4β→8)-(+)-catechin-3'-O-gallate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6765100 | Reaxys |