EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O12 |
| Net Charge | 0 |
| Average Mass | 578.526 |
| Monoisotopic Mass | 578.14243 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28+,29+/m0/s1 |
| InChIKey | XFZJEEAOWLFHDH-UKWJTHFESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.21.5 (thrombin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of thrombin (EC 3.4.21.5). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin B1 (CHEBI:75633) has functional parent (+)-catechin (CHEBI:15600) |
| procyanidin B1 (CHEBI:75633) has functional parent (−)-epicatechin (CHEBI:90) |
| procyanidin B1 (CHEBI:75633) has role anti-inflammatory agent (CHEBI:67079) |
| procyanidin B1 (CHEBI:75633) has role EC 3.4.21.5 (thrombin) inhibitor (CHEBI:65232) |
| procyanidin B1 (CHEBI:75633) has role metabolite (CHEBI:25212) |
| procyanidin B1 (CHEBI:75633) is a biflavonoid (CHEBI:50128) |
| procyanidin B1 (CHEBI:75633) is a hydroxyflavan (CHEBI:72010) |
| procyanidin B1 (CHEBI:75633) is a polyphenol (CHEBI:26195) |
| procyanidin B1 (CHEBI:75633) is a proanthocyanidin (CHEBI:26267) |
| Incoming Relation(s) |
| procyanidin B1 3-O-gallate (CHEBI:75651) has functional parent procyanidin B1 (CHEBI:75633) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) has functional parent procyanidin B1 (CHEBI:75633) |
| IUPAC Name |
|---|
| (2R,2'R,3R,3'S,4R)-2,2'-bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5,5',7,7'-hexol |
| Synonyms | Source |
|---|---|
| EC-(4b,8)-C | HMDB |
| Endotelon | HMDB |
| Epicatechin-(4beta->8)-ent-epicatechin | KEGG COMPOUND |
| Epicatechin(4β→8)catechin | HMDB |
| Proanthocyanidin B1 | HMDB |
| Procyanidin dimer B1 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00002917 | KNApSAcK |
| C10221 | KEGG COMPOUND |
| HMDB0029754 | HMDB |
| LMPK12030001 | LIPID MAPS |
| Procyanidin_B1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1339969 | Reaxys |
| CAS:82262-99-5 | KEGG COMPOUND |
| Citations |
|---|