EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O12 |
| Net Charge | 0 |
| Average Mass | 578.526 |
| Monoisotopic Mass | 578.14243 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28+,29+/m0/s1 |
| InChIKey | XFZJEEAOWLFHDH-UKWJTHFESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.5 (thrombin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of thrombin (EC 3.4.21.5). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin B1 (CHEBI:75633) has functional parent (+)-catechin (CHEBI:15600) |
| procyanidin B1 (CHEBI:75633) has functional parent (−)-epicatechin (CHEBI:90) |
| procyanidin B1 (CHEBI:75633) has role anti-inflammatory agent (CHEBI:67079) |
| procyanidin B1 (CHEBI:75633) has role EC 3.4.21.5 (thrombin) inhibitor (CHEBI:65232) |
| procyanidin B1 (CHEBI:75633) has role metabolite (CHEBI:25212) |
| procyanidin B1 (CHEBI:75633) is a biflavonoid (CHEBI:50128) |
| procyanidin B1 (CHEBI:75633) is a hydroxyflavan (CHEBI:72010) |
| procyanidin B1 (CHEBI:75633) is a polyphenol (CHEBI:26195) |
| procyanidin B1 (CHEBI:75633) is a proanthocyanidin (CHEBI:26267) |
| Incoming Relation(s) |
| procyanidin B1 3-O-gallate (CHEBI:75651) has functional parent procyanidin B1 (CHEBI:75633) |
| procyanidin B1 3'-O-gallate (CHEBI:75653) has functional parent procyanidin B1 (CHEBI:75633) |
| IUPAC Name |
|---|
| (2R,2'R,3R,3'S,4R)-2,2'-bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5,5',7,7'-hexol |
| Synonyms | Source |
|---|---|
| Epicatechin-(4beta->8)-ent-epicatechin | KEGG COMPOUND |
| Procyanidin dimer B1 | HMDB |
| Epicatechin(4β→8)catechin | HMDB |
| Endotelon | HMDB |
| EC-(4b,8)-C | HMDB |
| Proanthocyanidin B1 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C10221 | KEGG COMPOUND |
| HMDB0029754 | HMDB |
| Procyanidin_B1 | Wikipedia |
| LMPK12030001 | LIPID MAPS |
| C00002917 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1339969 | Reaxys |
| CAS:82262-99-5 | KEGG COMPOUND |
| Citations |
|---|