EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N8O5 |
| Net Charge | 0 |
| Average Mass | 580.690 |
| Monoisotopic Mass | 580.31217 |
| SMILES | COc1cc(/C=C/C(=O)NCCCCNC(=N)N)cc2c1O[C@H](c1ccc(O)cc1)[C@H]2C(=O)NCCCCNC(=N)N |
| InChI | InChI=1S/C29H40N8O5/c1-41-22-17-18(6-11-23(39)34-12-2-4-14-36-28(30)31)16-21-24(27(40)35-13-3-5-15-37-29(32)33)25(42-26(21)22)19-7-9-20(38)10-8-19/h6-11,16-17,24-25,38H,2-5,12-15H2,1H3,(H,34,39)(H,35,40)(H4,30,31,36)(H4,32,33,37)/b11-6+/t24-,25+/m0/s1 |
| InChIKey | LRLXAXGCQUOKIO-LHYVIZPNSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hordatine B (CHEBI:5763) has functional parent p-coumaroylagmatine (CHEBI:32818) |
| hordatine B (CHEBI:5763) has functional parent feruloylagmatine (CHEBI:75544) |
| hordatine B (CHEBI:5763) has role metabolite (CHEBI:25212) |
| hordatine B (CHEBI:5763) is a aromatic ether (CHEBI:35618) |
| hordatine B (CHEBI:5763) is a benzofurans (CHEBI:35259) |
| hordatine B (CHEBI:5763) is a dicarboxylic acid diamide (CHEBI:35779) |
| hordatine B (CHEBI:5763) is a guanidines (CHEBI:24436) |
| hordatine B (CHEBI:5763) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2S,3S)-N-(4-carbamimidamidobutyl)-5-{(1E)-3-[(4-carbamimidamidobutyl)amino]-3-oxoprop-1-en-1-yl}-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-carboxamide |