EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O9 |
| Net Charge | 0 |
| Average Mass | 354.311 |
| Monoisotopic Mass | 354.09508 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1[C@H](O)C[C@](O)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(21)25-14-11(19)6-16(24,15(22)23)7-12(14)20/h1-5,11-12,14,17-20,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
| InChIKey | GYFFKZTYYAFCTR-JUHZACGLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-trans-caffeoylquinic acid (CHEBI:75491) has functional parent (+)-quinic acid (CHEBI:36124) |
| 4-O-trans-caffeoylquinic acid (CHEBI:75491) has functional parent trans-caffeic acid (CHEBI:16433) |
| 4-O-trans-caffeoylquinic acid (CHEBI:75491) has role hepatoprotective agent (CHEBI:62868) |
| 4-O-trans-caffeoylquinic acid (CHEBI:75491) has role metabolite (CHEBI:25212) |
| 4-O-trans-caffeoylquinic acid (CHEBI:75491) is a cinnamate ester (CHEBI:36087) |
| 4-O-trans-caffeoylquinic acid (CHEBI:75491) is a cyclitol carboxylic acid (CHEBI:36123) |
| Incoming Relation(s) |
| 4-O-E-caffeoylquinic acid methyl ester (CHEBI:145092) has functional parent 4-O-trans-caffeoylquinic acid (CHEBI:75491) |
| IUPAC Name |
|---|
| (1S,3R,4S,5R)-4-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,3,5-trihydroxycyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| Cryptochlorogenic acid | HMDB |
| 4-(3,4-Dihydroxycinnamoyl)quinic acid | HMDB |
| 4-O-caffeoylquinic acid | ChEBI |
| 4-Caffeoylquinic acid | HMDB |
| 4-O-(E)-caffeoylquinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030653 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2708415 | Reaxys |
| CAS:905-99-7 | HMDB |
| Citations |
|---|