EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O6 |
| Net Charge | 0 |
| Average Mass | 192.167 |
| Monoisotopic Mass | 192.06339 |
| SMILES | O=C(O)[C@]1(O)C[C@H](O)[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C7H12O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3-5,8-10,13H,1-2H2,(H,11,12)/t3-,4-,5-,7+/m0/s1 |
| InChIKey | AAWZDTNXLSGCEK-DRMQKGJZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-quinic acid (CHEBI:36124) is a quinic acid (CHEBI:26493) |
| (+)-quinic acid (CHEBI:36124) is enantiomer of (−)-quinic acid (CHEBI:17521) |
| Incoming Relation(s) |
| 4-O-trans-caffeoylquinic acid (CHEBI:75491) has functional parent (+)-quinic acid (CHEBI:36124) |
| 5-O-cis-caffeoylquinic acid (CHEBI:75489) has functional parent (+)-quinic acid (CHEBI:36124) |
| (−)-quinic acid (CHEBI:17521) is enantiomer of (+)-quinic acid (CHEBI:36124) |
| IUPAC Names |
|---|
| (1R,3S,4R,5S)-1,3,4,5-tetrahydroxycyclohexanecarboxylic acid |
| 1D-1(OH),3,4/5-tetrahydroxycyclohexanecarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2212410 | Reaxys |