EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40O4 |
| Net Charge | 0 |
| Average Mass | 356.547 |
| Monoisotopic Mass | 356.29266 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | RZRNAYUHWVFMIP-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arachis hypogaea (ncbitaxon:3818) | cotyledon (BTO:0000300) | PubMed (11283027) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-oleoylglycerol (CHEBI:75342) has functional parent oleic acid (CHEBI:16196) |
| 1-oleoylglycerol (CHEBI:75342) has role plant metabolite (CHEBI:76924) |
| 1-oleoylglycerol (CHEBI:75342) is a 1-acylglycerol 18:1 (CHEBI:134130) |
| 1-oleoylglycerol (CHEBI:75342) is a monooleoylglycerol (CHEBI:75937) |
| Incoming Relation(s) |
| 1-oleoyl-sn-glycerol (CHEBI:75757) is a 1-oleoylglycerol (CHEBI:75342) |
| 3-oleoyl-sn-glycerol (CHEBI:75938) is a 1-oleoylglycerol (CHEBI:75342) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl (9Z)-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| 1-monooleoylglycerol | SUBMITTER |
| MG (18:1/0:0/0:0) | SUBMITTER |
| 1-oleoyl-rac-glycerol | LIPID MAPS |
| 1-(9Z-octadecenoyl)-rac-glycerol | LIPID MAPS |
| 1-monooleoyl-rac-glycerol | ChemIDplus |
| 2,3-dihydroxypropyl oleate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1-(9Z-octadecenoyl)-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMGL01010005 | LIPID MAPS |
| CPD-11690 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728977 | Reaxys |
| CAS:111-03-5 | ChemIDplus |
| Citations |
|---|