EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40O4 |
| Net Charge | 0 |
| Average Mass | 356.547 |
| Monoisotopic Mass | 356.29266 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-/t20-/m1/s1 |
| InChIKey | RZRNAYUHWVFMIP-GDCKJWNLSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oleoyl-sn-glycerol (CHEBI:75938) has functional parent oleic acid (CHEBI:16196) |
| 3-oleoyl-sn-glycerol (CHEBI:75938) is a 1-oleoylglycerol (CHEBI:75342) |
| 3-oleoyl-sn-glycerol (CHEBI:75938) is a 3-acyl-sn-glycerol (CHEBI:64760) |
| IUPAC Name |
|---|
| (2R)-2,3-dihydroxypropyl (9Z)-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| MG[0:0/0:0/18:1(ω-9)] | SUBMITTER |
| (R)-1-monoolein | ChEBI |
| (R)-glyceryl 1-monooleate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-(9Z-octadecenoyl)-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| OLC | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2055871 | Reaxys |