EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40O4 |
| Net Charge | 0 |
| Average Mass | 356.547 |
| Monoisotopic Mass | 356.29266 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)CO |
| InChI | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-/t20-/m0/s1 |
| InChIKey | RZRNAYUHWVFMIP-QJRAZLAKSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-oleoyl-sn-glycerol (CHEBI:75757) has functional parent oleic acid (CHEBI:16196) |
| 1-oleoyl-sn-glycerol (CHEBI:75757) is a 1-acyl-sn-glycerol (CHEBI:64683) |
| 1-oleoyl-sn-glycerol (CHEBI:75757) is a 1-oleoylglycerol (CHEBI:75342) |
| IUPAC Name |
|---|
| (2S)-2,3-dihydroxypropyl (9Z)-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| MG(18:1(ω-9)/0:0/0:0) | SUBMITTER |
| sn-1-monooleoylglycerol | SUBMITTER |
| MG(18:1) | HMDB |
| MG(18:1ω9/0:0) | HMDB |
| MG(18:1(9Z)/0:0/0:0) | HMDB |
| MG(18:1/0:0) | HMDB |
| UniProt Name | Source |
|---|---|
| 1-(9Z-octadecenoyl)-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011567 | HMDB |
| OLB | PDBeChem |
| FDB028280 | FooDB |
| 23010051 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6482893 | Reaxys |
| Citations |
|---|