EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11O2 |
| Net Charge | -1 |
| Average Mass | 163.196 |
| Monoisotopic Mass | 163.07645 |
| SMILES | O=C([O-])CCCc1ccccc1 |
| InChI | InChI=1S/C10H12O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12)/p-1 |
| InChIKey | OBKXEAXTFZPCHS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-phenylbutyrate (CHEBI:75317) is a carboxylic acid anion (CHEBI:29067) |
| 4-phenylbutyrate (CHEBI:75317) is conjugate base of 4-phenylbutyric acid (CHEBI:41500) |
| Incoming Relation(s) |
| sodium phenylbutyrate (CHEBI:75316) has part 4-phenylbutyrate (CHEBI:75317) |
| 4-phenylbutyric acid (CHEBI:41500) is conjugate acid of 4-phenylbutyrate (CHEBI:75317) |
| IUPAC Name |
|---|
| 4-phenylbutanoate |