EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | O=C(O)CCCc1ccccc1 |
| InChI | InChI=1S/C10H12O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12) |
| InChIKey | OBKXEAXTFZPCHS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-phenylbutyric acid (CHEBI:41500) has functional parent butyric acid (CHEBI:30772) |
| 4-phenylbutyric acid (CHEBI:41500) has role antineoplastic agent (CHEBI:35610) |
| 4-phenylbutyric acid (CHEBI:41500) has role apoptosis inducer (CHEBI:68495) |
| 4-phenylbutyric acid (CHEBI:41500) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| 4-phenylbutyric acid (CHEBI:41500) has role prodrug (CHEBI:50266) |
| 4-phenylbutyric acid (CHEBI:41500) is a monocarboxylic acid (CHEBI:25384) |
| 4-phenylbutyric acid (CHEBI:41500) is conjugate acid of 4-phenylbutyrate (CHEBI:75317) |
| Incoming Relation(s) |
| 4-phenylbutyrate (CHEBI:75317) is conjugate base of 4-phenylbutyric acid (CHEBI:41500) |
| IUPAC Name |
|---|
| 4-phenylbutanoic acid |
| Synonyms | Source |
|---|---|
| 4-PHENYL-BUTANOIC ACID | PDBeChem |
| 4-Phenyl-n-butyric acid | NIST Chemistry WebBook |
| Benzenebutyric acid | ChemIDplus |
| PBA | ChEBI |
| γ-phenylbutyric acid | ChemIDplus |
| γ-Phenyl-n-butyric acid | NIST Chemistry WebBook |
| Citations |
|---|