EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11O2.Na |
| Net Charge | 0 |
| Average Mass | 186.186 |
| Monoisotopic Mass | 186.06567 |
| SMILES | O=C([O-])CCCc1ccccc1.[Na+] |
| InChI | InChI=1S/C10H12O2.Na/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h1-3,5-6H,4,7-8H2,(H,11,12);/q;+1/p-1 |
| InChIKey | VPZRWNZGLKXFOE-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium phenylbutyrate (CHEBI:75316) has part 4-phenylbutyrate (CHEBI:75317) |
| sodium phenylbutyrate (CHEBI:75316) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| sodium phenylbutyrate (CHEBI:75316) has role geroprotector (CHEBI:176497) |
| sodium phenylbutyrate (CHEBI:75316) has role neuroprotective agent (CHEBI:63726) |
| sodium phenylbutyrate (CHEBI:75316) has role orphan drug (CHEBI:71031) |
| sodium phenylbutyrate (CHEBI:75316) has role prodrug (CHEBI:50266) |
| sodium phenylbutyrate (CHEBI:75316) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 4-phenylbutanoate |
| Synonyms | Source |
|---|---|
| 4PBA | ChEBI |
| Benzenebutanoic acid, sodium salt | ChemIDplus |
| Sodium 4-phenylbutyrate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Ammonaps | ChEBI |
| Buphenyl | KEGG DRUG |
| TriButyrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5068 | ChemSpider |
| CN102757334 | Patent |
| D05868 | KEGG DRUG |
| DBSALT002404 | DrugBank |
| FR2959129 | Patent |
| MX2010009933 | Patent |
| Sodium_phenylbutyrate | Wikipedia |
| US2009221714 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4039802 | Reaxys |
| CAS:1716-12-7 | ChemIDplus |
| Citations |
|---|