EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11O2.Na |
| Net Charge | 0 |
| Average Mass | 186.186 |
| Monoisotopic Mass | 186.06567 |
| SMILES | O=C([O-])CCCc1ccccc1.[Na+] |
| InChI | InChI=1S/C10H12O2.Na/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h1-3,5-6H,4,7-8H2,(H,11,12);/q;+1/p-1 |
| InChIKey | VPZRWNZGLKXFOE-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium phenylbutyrate (CHEBI:75316) has part 4-phenylbutyrate (CHEBI:75317) |
| sodium phenylbutyrate (CHEBI:75316) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| sodium phenylbutyrate (CHEBI:75316) has role geroprotector (CHEBI:176497) |
| sodium phenylbutyrate (CHEBI:75316) has role neuroprotective agent (CHEBI:63726) |
| sodium phenylbutyrate (CHEBI:75316) has role orphan drug (CHEBI:71031) |
| sodium phenylbutyrate (CHEBI:75316) has role prodrug (CHEBI:50266) |
| sodium phenylbutyrate (CHEBI:75316) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 4-phenylbutanoate |
| Synonyms | Source |
|---|---|
| 4PBA | ChEBI |
| Benzenebutanoic acid, sodium salt | ChemIDplus |
| Sodium 4-phenylbutyrate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Ammonaps | ChEBI |
| Buphenyl | KEGG DRUG |
| TriButyrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5068 | ChemSpider |
| CN102757334 | Patent |
| D05868 | KEGG DRUG |
| DBSALT002404 | DrugBank |
| FR2959129 | Patent |
| MX2010009933 | Patent |
| Sodium_phenylbutyrate | Wikipedia |
| US2009221714 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4039802 | Reaxys |
| CAS:1716-12-7 | ChemIDplus |
| Citations |
|---|