EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13O6 |
| Net Charge | +1 |
| Average Mass | 301.274 |
| Monoisotopic Mass | 301.07066 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)ccc1O |
| InChI | InChI=1S/C16H12O6/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16/h2-7H,1H3,(H3-,17,18,19,20)/p+1 |
| InChIKey | XFDQJKDGGOEYPI-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peonidin (CHEBI:75314) has role antineoplastic agent (CHEBI:35610) |
| peonidin (CHEBI:75314) has role antioxidant (CHEBI:22586) |
| peonidin (CHEBI:75314) has role apoptosis inducer (CHEBI:68495) |
| peonidin (CHEBI:75314) has role metabolite (CHEBI:25212) |
| peonidin (CHEBI:75314) is a 5-hydroxyanthocyanidin (CHEBI:140277) |
| peonidin (CHEBI:75314) is conjugate acid of peonidin(1−) (CHEBI:144779) |
| Incoming Relation(s) |
| peonidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75707) has functional parent peonidin (CHEBI:75314) |
| peonidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75706) has functional parent peonidin (CHEBI:75314) |
| peonidin 3-O-(6-O-acetyl-β-D-glucoside) (CHEBI:75697) has functional parent peonidin (CHEBI:75314) |
| peonidin 3-O-β-D-glucoside (CHEBI:74793) has functional parent peonidin (CHEBI:75314) |
| peonidin chloride (CHEBI:75033) has part peonidin (CHEBI:75314) |
| peonidin(1−) (CHEBI:144779) is conjugate base of peonidin (CHEBI:75314) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromenium |
| Synonyms | Source |
|---|---|
| 3,4',5,7-tetrahydroxy-3'-methoxyflavylium | ChEBI |
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium | ChEBI |
| 3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium chloride | KEGG COMPOUND |
| peonidin(1+) | ChEBI |
| peonidin cation | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08726 | KEGG COMPOUND |
| CPD-15052 | MetaCyc |
| LMPK12010006 | LIPID MAPS |
| Peonidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1690552 | Reaxys |
| CAS:134-01-0 | ChemIDplus |
| CAS:134-01-0 | KEGG COMPOUND |
| Citations |
|---|