EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23O11 |
| Net Charge | +1 |
| Average Mass | 463.415 |
| Monoisotopic Mass | 463.12349 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C22H22O11/c1-30-15-4-9(2-3-12(15)25)21-16(7-11-13(26)5-10(24)6-14(11)31-21)32-22-20(29)19(28)18(27)17(8-23)33-22/h2-7,17-20,22-23,27-29H,8H2,1H3,(H2-,24,25,26)/p+1/t17-,18-,19+,20-,22-/m1/s1 |
| InChIKey | ZZWPMFROUHHAKY-OUUKCGNVSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peonidin 3-O-β-D-glucoside (CHEBI:74793) has functional parent peonidin (CHEBI:75314) |
| peonidin 3-O-β-D-glucoside (CHEBI:74793) has role antioxidant (CHEBI:22586) |
| peonidin 3-O-β-D-glucoside (CHEBI:74793) has role plant metabolite (CHEBI:76924) |
| peonidin 3-O-β-D-glucoside (CHEBI:74793) is a anthocyanin cation (CHEBI:35218) |
| peonidin 3-O-β-D-glucoside (CHEBI:74793) is a monosaccharide derivative (CHEBI:63367) |
| peonidin 3-O-β-D-glucoside (CHEBI:74793) is a β-D-glucoside (CHEBI:22798) |
| peonidin 3-O-β-D-glucoside (CHEBI:74793) is conjugate acid of peonidin 3-O-β-D-glucoside betaine (CHEBI:144780) |
| Incoming Relation(s) |
| peonidin 3-O-β-D-glucoside betaine (CHEBI:144780) is conjugate base of peonidin 3-O-β-D-glucoside (CHEBI:74793) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromenium-3-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Peonidin-3-glucoside | KEGG COMPOUND |
| Peonidin 3-O-glucoside | HMDB |
| Peonidin-3-glucoside | HMDB |
| 3'-O-methylcyanidin 3-O-β-D-glucoside | ChEBI |
| Oxycoccicyanin | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C12141 | KEGG COMPOUND |
| HMDB0013689 | HMDB |
| C12141 | KEGG COMPOUND |
| Peonidin-3-O-glucoside | Wikipedia |
| LMPK12010233 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1695761 | Reaxys |
| CAS:68795-37-9 | HMDB |
| CAS:68795-37-9 | KEGG COMPOUND |
| Citations |
|---|