EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13O6.Cl |
| Net Charge | 0 |
| Average Mass | 336.727 |
| Monoisotopic Mass | 336.04007 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)ccc1O.[Cl-] |
| InChI | InChI=1S/C16H12O6.ClH/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16;/h2-7H,1H3,(H3-,17,18,19,20);1H |
| InChIKey | OGBSHLKSHNAPEW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peonidin chloride (CHEBI:75033) has part peonidin (CHEBI:75314) |
| peonidin chloride (CHEBI:75033) has role antineoplastic agent (CHEBI:35610) |
| peonidin chloride (CHEBI:75033) has role antioxidant (CHEBI:22586) |
| peonidin chloride (CHEBI:75033) has role apoptosis inducer (CHEBI:68495) |
| peonidin chloride (CHEBI:75033) has role metabolite (CHEBI:25212) |
| peonidin chloride (CHEBI:75033) is a anthocyanidin chloride (CHEBI:38696) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromenium chloride |
| Synonyms | Source |
|---|---|
| Peonidin | KEGG COMPOUND |
| 3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium chloride | KEGG COMPOUND |
| 3,4',5,7-tetrahydroxy-3'-methoxyflavylium chloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08726 | KEGG COMPOUND |
| HMDB0005797 | HMDB |
| Peonidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3924296 | Reaxys |
| CAS:134-01-0 | KEGG COMPOUND |
| CAS:134-01-0 | ChemIDplus |
| Citations |
|---|