EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13O6.Cl |
| Net Charge | 0 |
| Average Mass | 336.727 |
| Monoisotopic Mass | 336.04007 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)ccc1O.[Cl-] |
| InChI | InChI=1S/C16H12O6.ClH/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16;/h2-7H,1H3,(H3-,17,18,19,20);1H |
| InChIKey | OGBSHLKSHNAPEW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peonidin chloride (CHEBI:75033) has part peonidin (CHEBI:75314) |
| peonidin chloride (CHEBI:75033) has role antineoplastic agent (CHEBI:35610) |
| peonidin chloride (CHEBI:75033) has role antioxidant (CHEBI:22586) |
| peonidin chloride (CHEBI:75033) has role apoptosis inducer (CHEBI:68495) |
| peonidin chloride (CHEBI:75033) has role metabolite (CHEBI:25212) |
| peonidin chloride (CHEBI:75033) is a anthocyanidin chloride (CHEBI:38696) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromenium chloride |
| Synonyms | Source |
|---|---|
| 3,4',5,7-tetrahydroxy-3'-methoxyflavylium chloride | ChEBI |
| 3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-benzopyrylium chloride | KEGG COMPOUND |
| Peonidin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08726 | KEGG COMPOUND |
| HMDB0005797 | HMDB |
| Peonidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3924296 | Reaxys |
| CAS:134-01-0 | ChemIDplus |
| CAS:134-01-0 | KEGG COMPOUND |
| Citations |
|---|