EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13ClN6O2 |
| Net Charge | 0 |
| Average Mass | 272.696 |
| Monoisotopic Mass | 272.07885 |
| SMILES | Cc1ncc(CNC(=O)N(CCCl)N=O)c(N)n1 |
| InChI | InChI=1S/C9H13ClN6O2/c1-6-12-4-7(8(11)14-6)5-13-9(17)16(15-18)3-2-10/h4H,2-3,5H2,1H3,(H,13,17)(H2,11,12,14) |
| InChIKey | VFEDRRNHLBGPNN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimustine (CHEBI:75270) has role alkylating agent (CHEBI:22333) |
| nimustine (CHEBI:75270) has role antineoplastic agent (CHEBI:35610) |
| nimustine (CHEBI:75270) is a N-nitrosoureas (CHEBI:76551) |
| nimustine (CHEBI:75270) is a aminopyrimidine (CHEBI:38338) |
| nimustine (CHEBI:75270) is a organochlorine compound (CHEBI:36683) |
| nimustine (CHEBI:75270) is conjugate base of nimustine(1+) (CHEBI:75271) |
| Incoming Relation(s) |
| nimustine(1+) (CHEBI:75271) is conjugate acid of nimustine (CHEBI:75270) |
| IUPAC Name |
|---|
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-1-(2-chloroethyl)-1-nitrosourea |
| INNs | Source |
|---|---|
| nimustine | KEGG DRUG |
| nimustinum | ChemIDplus |
| nimustina | ChemIDplus |
| nimustine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(4-Amino-2-methyl-5-pyrimidinyl)methyl-3-(2-chloroethyl)-3-nitrosourea | ChemIDplus |
| 3-(4-Amino-2-methyl-5-pyrimidinyl)methyl-1-(2-chloroethyl)-1-nitrosourea | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:685903 | Reaxys |
| CAS:42471-28-3 | KEGG DRUG |
| CAS:42471-28-3 | ChemIDplus |
| Citations |
|---|