EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14ClN6O2 |
| Net Charge | +1 |
| Average Mass | 273.704 |
| Monoisotopic Mass | 273.08613 |
| SMILES | Cc1nc(N)c(CNC(=O)N(CCCl)N=O)c[nH+]1 |
| InChI | InChI=1S/C9H13ClN6O2/c1-6-12-4-7(8(11)14-6)5-13-9(17)16(15-18)3-2-10/h4H,2-3,5H2,1H3,(H,13,17)(H2,11,12,14)/p+1 |
| InChIKey | VFEDRRNHLBGPNN-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimustine(1+) (CHEBI:75271) is a organic cation (CHEBI:25697) |
| nimustine(1+) (CHEBI:75271) is conjugate acid of nimustine (CHEBI:75270) |
| Incoming Relation(s) |
| nimustine hydrochloride (CHEBI:7576) has part nimustine(1+) (CHEBI:75271) |
| nimustine (CHEBI:75270) is conjugate base of nimustine(1+) (CHEBI:75271) |
| IUPAC Name |
|---|
| 4-amino-5-({[(2-chloroethyl)(nitroso)carbamoyl]amino}methyl)-2-methylpyrimidin-1-ium |
| Synonym | Source |
|---|---|
| nimustine cation | ChEBI |