EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O5S.C29H38N4O9 |
| Net Charge | 0 |
| Average Mass | 937.038 |
| Monoisotopic Mass | 936.35752 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(=O)NCN4CCN(CCO)CC4)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O.[H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C29H38N4O9.C16H18N2O5S/c1-28(41)15-5-4-6-18(35)19(15)23(36)20-16(28)13-17-22(31(2)3)24(37)21(26(39)29(17,42)25(20)38)27(40)30-14-33-9-7-32(8-10-33)11-12-34;1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9/h4-6,16-17,22,34-35,37-38,41-42H,7-14H2,1-3H3,(H,30,40);3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t16-,17-,22-,28+,29-;11-,12+,14-/m01/s1 |
| InChIKey | MEGKRPMNPGTIIG-VNYBMUHKSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penimepicycline (CHEBI:75258) has part phenoxymethylpenicillin(1−) (CHEBI:51355) |
| penimepicycline (CHEBI:75258) has part pipacycline(1+) (CHEBI:75267) |
| penimepicycline (CHEBI:75258) has role antimicrobial agent (CHEBI:33281) |
| penimepicycline (CHEBI:75258) is a penicillinate salt (CHEBI:75260) |
| INNs | Source |
|---|---|
| penimepicycline | KEGG DRUG |
| penimepicyclinum | ChemIDplus |
| penimepiciclina | WHO MedNet |
| pénimépicycline | WHO MedNet |
| Synonyms | Source |
|---|---|
| Penetracyne | ChemIDplus |
| Mepicycline penicillinate | ChemIDplus |
| Hydrocycline | ChemIDplus |
| Penimepiciclina | ChemIDplus |
| pipacycline/penicillin V | ChEBI |
| pipacycline-penicillin V | ChEBI |
| Citations |
|---|