EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N2O5S |
| Net Charge | -1 |
| Average Mass | 349.388 |
| Monoisotopic Mass | 349.08637 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/p-1/t11-,12+,14-/m1/s1 |
| InChIKey | BPLBGHOLXOTWMN-MBNYWOFBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenoxymethylpenicillin(1−) (CHEBI:51355) is a penicillinate anion (CHEBI:51356) |
| phenoxymethylpenicillin(1−) (CHEBI:51355) is conjugate base of phenoxymethylpenicillin (CHEBI:27446) |
| Incoming Relation(s) |
| penimepicycline (CHEBI:75258) has part phenoxymethylpenicillin(1−) (CHEBI:51355) |
| phenoxymethylpenicillin benzathine (CHEBI:31973) has part phenoxymethylpenicillin(1−) (CHEBI:51355) |
| phenoxymethylpenicillin hydrabamine (CHEBI:52173) has part phenoxymethylpenicillin(1−) (CHEBI:51355) |
| phenoxymethylpenicillin potassium (CHEBI:7967) has part phenoxymethylpenicillin(1−) (CHEBI:51355) |
| phenoxymethylpenicillin (CHEBI:27446) is conjugate acid of phenoxymethylpenicillin(1−) (CHEBI:51355) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-[(phenoxyacetyl)amino]penam-3α-carboxylate |
| UniProt Name | Source |
|---|---|
| penicillin V | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3916461 | Beilstein |