EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C29H38N4O9 |
| Net Charge | +1 |
| Average Mass | 587.650 |
| Monoisotopic Mass | 587.27116 |
| SMILES | [H+].[H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(=O)NCN4CCN(CCO)CC4)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C29H38N4O9/c1-28(41)15-5-4-6-18(35)19(15)23(36)20-16(28)13-17-22(31(2)3)24(37)21(26(39)29(17,42)25(20)38)27(40)30-14-33-9-7-32(8-10-33)11-12-34/h4-6,16-17,22,34-35,37-38,41-42H,7-14H2,1-3H3,(H,30,40)/p+1/t16-,17-,22-,28+,29-/m0/s1 |
| InChIKey | XATZHCXBMKRRDO-REHNUXHNSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pipacycline(1+) (CHEBI:75267) is a organic cation (CHEBI:25697) |
| pipacycline(1+) (CHEBI:75267) is conjugate acid of pipacycline (CHEBI:75262) |
| Incoming Relation(s) |
| penimepicycline (CHEBI:75258) has part pipacycline(1+) (CHEBI:75267) |
| pipacycline (CHEBI:75262) is conjugate base of pipacycline(1+) (CHEBI:75267) |
| Synonym | Source |
|---|---|
| pipacycline cation | ChEBI |