EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17458 - N-methyltyramine
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | CNCCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO/c1-10-7-6-8-2-4-9(11)5-3-8/h2-5,10-11H,6-7H2,1H3 |
| InChIKey | AXVZFRBSCNEKPQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyltyramine (CHEBI:17458) has role mouse metabolite (CHEBI:75771) |
| N-methyltyramine (CHEBI:17458) is a tyramines (CHEBI:27175) |
| N-methyltyramine (CHEBI:17458) is conjugate base of N-methyltyraminium (CHEBI:58155) |
| Incoming Relation(s) |
| N,O-dimethyltyramine (CHEBI:75143) has functional parent N-methyltyramine (CHEBI:17458) |
| N-methyltyraminium (CHEBI:58155) is conjugate acid of N-methyltyramine (CHEBI:17458) |
| IUPAC Name |
|---|
| 4-[2-(methylamino)ethyl]phenol |
| Synonyms | Source |
|---|---|
| 4-Hydroxy-N-methylphenethylamine | ChemIDplus |
| Methyl-4-tyramine | ChEBI |
| N-Methyltyramine | KEGG COMPOUND |
| p-(2-Methylaminoethyl)phenol | ChemIDplus |