EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75095 - chrysin
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | RTIXKCRFFJGDFG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 2.7.11.18 (myosin-light-chain kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of myosin-light-chain kinase (EC 2.7.11.18). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysin (CHEBI:75095) has role anti-inflammatory agent (CHEBI:67079) |
| chrysin (CHEBI:75095) has role antineoplastic agent (CHEBI:35610) |
| chrysin (CHEBI:75095) has role antioxidant (CHEBI:22586) |
| chrysin (CHEBI:75095) has role EC 2.7.11.18 (myosin-light-chain kinase) inhibitor (CHEBI:78763) |
| chrysin (CHEBI:75095) has role hepatoprotective agent (CHEBI:62868) |
| chrysin (CHEBI:75095) has role plant metabolite (CHEBI:76924) |
| chrysin (CHEBI:75095) is a 7-hydroxyflavonol (CHEBI:52267) |
| chrysin (CHEBI:75095) is a dihydroxyflavone (CHEBI:38686) |
| Incoming Relation(s) |
| 6-(3,3-dimethylallyl)chrysin (CHEBI:2161) has functional parent chrysin (CHEBI:75095) |
| 6-geranylchrysin (CHEBI:2185) has functional parent chrysin (CHEBI:75095) |
| 6,8-di-(3,3-dimethylallyl)chrysin (CHEBI:2155) has functional parent chrysin (CHEBI:75095) |
| 8-(3,3-dimethylallyl)chrysin (CHEBI:2305) has functional parent chrysin (CHEBI:75095) |
| 8-geranylchrysin (CHEBI:2321) has functional parent chrysin (CHEBI:75095) |
| chrysin 5,7-dimethyl ether (CHEBI:3684) has functional parent chrysin (CHEBI:75095) |
| Synonyms | Source |
|---|---|
| 5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one | ChEBI |
| 5,7-Dihydroxy-2-phenyl-4H-benzo(b)pyran-4-one | ChEBI |
| 5,7-dihydroxy-2-phenylchromen-4-one | PDBeChem |
| 5,7-Dihydroxyflavone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 57D | PDBeChem |
| C00003794 | KNApSAcK |
| C10028 | KEGG COMPOUND |
| Chrysin | Wikipedia |
| CPD-8184 | MetaCyc |
| HMDB0036619 | HMDB |
| LMPK12110189 | LIPID MAPS |
| LSM-6566 | LINCS |
| Citations |
|---|