EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O4 |
| Net Charge | 0 |
| Average Mass | 322.360 |
| Monoisotopic Mass | 322.12051 |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C20H18O4/c1-12(2)8-9-14-15(21)10-16(22)19-17(23)11-18(24-20(14)19)13-6-4-3-5-7-13/h3-8,10-11,21-22H,9H2,1-2H3 |
| InChIKey | WVBTWALEDCJRKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(3,3-dimethylallyl)chrysin (CHEBI:2305) has functional parent chrysin (CHEBI:75095) |
| 8-(3,3-dimethylallyl)chrysin (CHEBI:2305) has role plant metabolite (CHEBI:76924) |
| 8-(3,3-dimethylallyl)chrysin (CHEBI:2305) is a 7-hydroxyflavonol (CHEBI:52267) |
| 8-(3,3-dimethylallyl)chrysin (CHEBI:2305) is a dihydroxyflavone (CHEBI:38686) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-8-(3-methylbut-2-en-1-yl)-2-phenyl-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 8-(3,3-DMA)chrysin | KEGG COMPOUND |
| 8-prenylchrysin | ChEBI |