EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O4 |
| Net Charge | 0 |
| Average Mass | 282.295 |
| Monoisotopic Mass | 282.08921 |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C17H14O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | JRFZSUMZAUHNSL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boesenbergia rotunda (ncbitaxon:97729) | rhizome (BTO:0001181) | DOI (10.1016/0031-9422(83)83075-1) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysin 5,7-dimethyl ether (CHEBI:3684) has functional parent chrysin (CHEBI:75095) |
| chrysin 5,7-dimethyl ether (CHEBI:3684) has role plant metabolite (CHEBI:76924) |
| chrysin 5,7-dimethyl ether (CHEBI:3684) is a dimethoxyflavone (CHEBI:23798) |
| IUPAC Name |
|---|
| 5,7-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 5,7-Dimethoxyflavone | KEGG COMPOUND |
| chrysin dimethyl ether | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10029 | KEGG COMPOUND |
| C00001028 | KNApSAcK |
| HMDB0036620 | HMDB |
| LMPK12110188 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:285983 | Reaxys |
| CAS:21392-57-4 | KEGG COMPOUND |
| CAS:21392-57-4 | ChemIDplus |