EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34Cl2NO5 |
| Net Charge | +1 |
| Average Mass | 487.444 |
| Monoisotopic Mass | 486.18085 |
| SMILES | OCc1cc([C@@H](O)C[NH2+]CCCCCCOCCOCc2c(Cl)cccc2Cl)ccc1O |
| InChI | InChI=1S/C24H33Cl2NO5/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28/h5-9,14,24,27-30H,1-4,10-13,15-17H2/p+1/t24-/m0/s1 |
| InChIKey | DAFYYTQWSAWIGS-DEOSSOPVSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vilanterol(1+) (CHEBI:75039) is a ammonium ion derivative (CHEBI:35274) |
| vilanterol(1+) (CHEBI:75039) is a organic cation (CHEBI:25697) |
| vilanterol(1+) (CHEBI:75039) is conjugate acid of vilanterol (CHEBI:75037) |
| Incoming Relation(s) |
| vilanterol trifenate (CHEBI:75040) has part vilanterol(1+) (CHEBI:75039) |
| vilanterol (CHEBI:75037) is conjugate base of vilanterol(1+) (CHEBI:75039) |
| IUPAC Name |
|---|
| 6-{2-[(2,6-dichlorobenzyl)oxy]ethoxy}-N-{(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl}hexan-1-aminium |
| Synonym | Source |
|---|---|
| vilanterol cation | ChEBI |