EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O2.C24H33Cl2NO5 |
| Net Charge | 0 |
| Average Mass | 774.782 |
| Monoisotopic Mass | 773.28861 |
| SMILES | O=C(O)C(c1ccccc1)(c1ccccc1)c1ccccc1.OCc1cc([C@@H](O)CNCCCCCCOCCOCc2c(Cl)cccc2Cl)ccc1O |
| InChI | InChI=1S/C24H33Cl2NO5.C20H16O2/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28;21-19(22)20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h5-9,14,24,27-30H,1-4,10-13,15-17H2;1-15H,(H,21,22)/t24-;/m0./s1 |
| InChIKey | KLOLZALDXGTNQE-JIDHJSLPSA-N |
| Roles Classification |
|---|
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vilanterol trifenate (CHEBI:75040) has part vilanterol(1+) (CHEBI:75039) |
| vilanterol trifenate (CHEBI:75040) has role bronchodilator agent (CHEBI:35523) |
| vilanterol trifenate (CHEBI:75040) has role β-adrenergic agonist (CHEBI:35522) |
| vilanterol trifenate (CHEBI:75040) is a triphenylacetate salt (CHEBI:75042) |
| Incoming Relation(s) |
| Breo Ellipta (CHEBI:75043) has part vilanterol trifenate (CHEBI:75040) |
| IUPAC Names |
|---|
| 4-{(1R)-2-[(6-{2-[(2,6-dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol triphenylacetate |
| 6-{2-[(2,6-dichlorobenzyl)oxy]ethoxy}-N-{(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl}hexan-1-aminium triphenylacetate |
| Synonyms | Source |
|---|---|
| vilanterol triphenylacetate | ChEBI |
| GW 642444M | ChemIDplus |
| GW642444M | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09697 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20449900 | Reaxys |
| CAS:503070-58-4 | ChemIDplus |
| Citations |
|---|