EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75037 - vilanterol
| Formula | C24H33Cl2NO5 |
| Net Charge | 0 |
| Average Mass | 486.436 |
| Monoisotopic Mass | 485.17358 |
| SMILES | OCc1cc([C@@H](O)CNCCCCCCOCCOCc2c(Cl)cccc2Cl)ccc1O |
| InChI | InChI=1S/C24H33Cl2NO5/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28/h5-9,14,24,27-30H,1-4,10-13,15-17H2/t24-/m0/s1 |
| InChIKey | DAFYYTQWSAWIGS-DEOSSOPVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vilanterol (CHEBI:75037) has role bronchodilator agent (CHEBI:35523) |
| vilanterol (CHEBI:75037) has role β-adrenergic agonist (CHEBI:35522) |
| vilanterol (CHEBI:75037) is a benzyl alcohols (CHEBI:22743) |
| vilanterol (CHEBI:75037) is a dichlorobenzene (CHEBI:23697) |
| vilanterol (CHEBI:75037) is a ether (CHEBI:25698) |
| vilanterol (CHEBI:75037) is a phenols (CHEBI:33853) |
| vilanterol (CHEBI:75037) is a secondary amino compound (CHEBI:50995) |
| vilanterol (CHEBI:75037) is conjugate base of vilanterol(1+) (CHEBI:75039) |
| Incoming Relation(s) |
| Anoro Ellipta (CHEBI:79039) has part vilanterol (CHEBI:75037) |
| vilanterol(1+) (CHEBI:75039) is conjugate acid of vilanterol (CHEBI:75037) |
| IUPAC Name |
|---|
| 4-{(1R)-2-[(6-{2-[(2,6-dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol |
| INNs | Source |
|---|---|
| vilanterol | ChemIDplus |
| vilanterol | WHO MedNet |
| vilantérol | WHO MedNet |
| vilanterolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| GW642444x | ChemIDplus |
| GW-642444x | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09696 | KEGG DRUG |
| Vilanterol | Wikipedia |
| 4799 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11820500 | Reaxys |
| CAS:503068-34-6 | KEGG DRUG |
| CAS:503068-34-6 | ChemIDplus |
| Citations |
|---|