EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O4 |
| Net Charge | 0 |
| Average Mass | 154.121 |
| Monoisotopic Mass | 154.02661 |
| SMILES | O=C1C=C2C(=CCOC2O)O1 |
| InChI | InChI=1S/C7H6O4/c8-6-3-4-5(11-6)1-2-10-7(4)9/h1,3,7,9H,2H2 |
| InChIKey | ZRWPUFFVAOMMNM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. mycotoxin Poisonous substance produced by fungi. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| patulin (CHEBI:74926) has role Aspergillus metabolite (CHEBI:76956) |
| patulin (CHEBI:74926) has role Penicillium metabolite (CHEBI:76964) |
| patulin (CHEBI:74926) has role antimicrobial agent (CHEBI:33281) |
| patulin (CHEBI:74926) has role carcinogenic agent (CHEBI:50903) |
| patulin (CHEBI:74926) has role mutagen (CHEBI:25435) |
| patulin (CHEBI:74926) has role mycotoxin (CHEBI:25442) |
| patulin (CHEBI:74926) is a furopyran (CHEBI:74927) |
| patulin (CHEBI:74926) is a lactol (CHEBI:38131) |
| patulin (CHEBI:74926) is a γ-lactone (CHEBI:37581) |
| Incoming Relation(s) |
| patulin‒4-bromothiophenol adduct (CHEBI:189530) has functional parent patulin (CHEBI:74926) |
| patulin‒4-bromothiophenol hapten (CHEBI:189533) has functional parent patulin (CHEBI:74926) |
| IUPAC Name |
|---|
| 4-hydroxy-4H-furo[3,2-c]pyran-2(6H)-one |
| Synonyms | Source |
|---|---|
| (2,4-dihydroxy-2H-pyran-3(6H)-ylidene)acetic acid, 3,4-lactone | ChemIDplus |
| (2,4-dihydroxy-2H-pyran-3(6H)-ylidene)acetic acid-3,4-lactone | ChemIDplus |
| 4,6-dihydro-4-hydroxy-2H-furo(3,2-c)pyran-2-one | ChemIDplus |
| clavacin | ChemIDplus |
| clavatin | ChemIDplus |
| claviform | ChemIDplus |
| UniProt Name | Source |
|---|---|
| patulin | UniProt |
| Citations |
|---|