EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16Br2O4S2 |
| Net Charge | 0 |
| Average Mass | 532.275 |
| Monoisotopic Mass | 529.88568 |
| SMILES | O=C(O)C/C(=C/Sc1ccc(Br)cc1)C(=O)C(CO)Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H16Br2O4S2/c20-13-1-5-15(6-2-13)26-11-12(9-18(23)24)19(25)17(10-22)27-16-7-3-14(21)4-8-16/h1-8,11,17,22H,9-10H2,(H,23,24)/b12-11- |
| InChIKey | RNRIQUGCLTZZJL-QXMHVHEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| patulin‒4-bromothiophenol adduct (CHEBI:189530) has functional parent patulin (CHEBI:74926) |
| patulin‒4-bromothiophenol adduct (CHEBI:189530) has role reagent (CHEBI:33893) |
| patulin‒4-bromothiophenol adduct (CHEBI:189530) is a monocarboxylic acid (CHEBI:25384) |
| patulin‒4-bromothiophenol adduct (CHEBI:189530) is a organobromine compound (CHEBI:37141) |
| patulin‒4-bromothiophenol adduct (CHEBI:189530) is a organosulfur compound (CHEBI:33261) |
| IUPAC Name |
|---|
| (3Z)-5-[(4-bromophenyl)sulfanyl]-3-{[(4-bromophenyl)sulfanyl]methylidene}-6-hydroxy-4-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| (3Z)-5-[(4-bromophenyl)sulfanyl]-3-{[(4-bromophenyl)sulfanyl]methylene}-6-hydroxy-4-oxohexanoic acid | IUPAC |
| (3Z)-5-[(4-bromophenyl)thio]-3-[[(4-bromophenyl)thio]methylene]-6-hydroxy-4-oxohexanoic acid | ChEBI |
| Citations |
|---|