EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21Br2NO5S2 |
| Net Charge | 0 |
| Average Mass | 603.354 |
| Monoisotopic Mass | 600.92279 |
| SMILES | O=C(O)CCNC(=O)C/C(=C/Sc1ccc(Br)cc1)C(=O)C(CO)Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21Br2NO5S2/c23-15-1-5-17(6-2-15)31-13-14(11-20(27)25-10-9-21(28)29)22(30)19(12-26)32-18-7-3-16(24)4-8-18/h1-8,13,19,26H,9-12H2,(H,25,27)(H,28,29)/b14-13- |
| InChIKey | ITBYEGNKUVQYNM-YPKPFQOOSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| Application: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| patulin‒4-bromothiophenol hapten (CHEBI:189533) has functional parent patulin (CHEBI:74926) |
| patulin‒4-bromothiophenol hapten (CHEBI:189533) has role hapten (CHEBI:59174) |
| patulin‒4-bromothiophenol hapten (CHEBI:189533) has role reagent (CHEBI:33893) |
| patulin‒4-bromothiophenol hapten (CHEBI:189533) is a amino-acid derivative (CHEBI:83821) |
| patulin‒4-bromothiophenol hapten (CHEBI:189533) is a organobromine compound (CHEBI:37141) |
| patulin‒4-bromothiophenol hapten (CHEBI:189533) is a organosulfur compound (CHEBI:33261) |
| IUPAC Name |
|---|
| N-[(3Z)-5-[(4-bromophenyl)sulfanyl]-3-{[(4-bromophenyl)sulfanyl]methylidene}-6-hydroxy-4-oxohexanoyl]-β-alanine |
| Synonyms | Source |
|---|---|
| N-[(3Z)-5-[(4-bromophenyl)sulfanyl]-3-{[(4-bromophenyl)sulfanyl]methylene}-6-hydroxy-4-oxohexanoyl]-β-alanine | IUPAC |
| N-[(3Z)-5-[(4-bromophenyl)thio]-3-[[(4-bromophenyl)thio]methylene]-6-hydroxy-1,4-dioxohexyl]-β-alanine | ChEBI |
| Citations |
|---|