EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C9H11N3O4 |
| Net Charge | +1 |
| Average Mass | 226.212 |
| Monoisotopic Mass | 226.08223 |
| SMILES | N=c1ccn2c(n1)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]12.[H+] |
| InChI | InChI=1S/C9H11N3O4/c10-5-1-2-12-8-7(16-9(12)11-5)6(14)4(3-13)15-8/h1-2,4,6-8,10,13-14H,3H2/p+1/t4-,6-,7+,8-/m1/s1 |
| InChIKey | BBDAGFIXKZCXAH-CCXZUQQUSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ancitabine(1+) (CHEBI:74842) is a organic cation (CHEBI:25697) |
| ancitabine(1+) (CHEBI:74842) is conjugate acid of ancitabine (CHEBI:74838) |
| Incoming Relation(s) |
| ancitabine hydrochloride (CHEBI:74843) has part ancitabine(1+) (CHEBI:74842) |
| ancitabine (CHEBI:74838) is conjugate base of ancitabine(1+) (CHEBI:74842) |