EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N3O4 |
| Net Charge | 0 |
| Average Mass | 225.204 |
| Monoisotopic Mass | 225.07496 |
| SMILES | N=c1ccn2c(n1)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]12 |
| InChI | InChI=1S/C9H11N3O4/c10-5-1-2-12-8-7(16-9(12)11-5)6(14)4(3-13)15-8/h1-2,4,6-8,10,13-14H,3H2/t4-,6-,7+,8-/m1/s1 |
| InChIKey | BBDAGFIXKZCXAH-CCXZUQQUSA-N |
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ancitabine (CHEBI:74838) has role antimetabolite (CHEBI:35221) |
| ancitabine (CHEBI:74838) has role antineoplastic agent (CHEBI:35610) |
| ancitabine (CHEBI:74838) has role prodrug (CHEBI:50266) |
| ancitabine (CHEBI:74838) is a diol (CHEBI:23824) |
| ancitabine (CHEBI:74838) is a organic heterotricyclic compound (CHEBI:26979) |
| ancitabine (CHEBI:74838) is conjugate base of ancitabine(1+) (CHEBI:74842) |
| Incoming Relation(s) |
| ancitabine(1+) (CHEBI:74842) is conjugate acid of ancitabine (CHEBI:74838) |
| IUPAC Name |
|---|
| (2R,3R,3aS,9aR)-2-(hydroxymethyl)-6-imino-2,3,3a,9a-tetrahydro-6H-furo[2',3':4,5][1,3]oxazolo[3,2-a]pyrimidin-3-ol |
| INNs | Source |
|---|---|
| ancitabina | ChemIDplus |
| ancitabine | WHO MedNet |
| ancitabine | ChemIDplus |
| ancitabinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,2'-anhydro-1-(β-D-arabinofuranosyl)cytosine | ChEBI |
| 2,2'-anhydroarabinosylcytosine | ChemIDplus |
| 2,2'-anhydro-AraC | ChEBI |
| 2,2'-anhydrocytidine | ChemIDplus |
| 2,2'-cyclocytidine | ChemIDplus |
| 2,2'-O-cyclocytidine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:669322 | Reaxys |
| CAS:31698-14-3 | ChemIDplus |
| Citations |
|---|