EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N3O4.HCl |
| Net Charge | 0 |
| Average Mass | 261.665 |
| Monoisotopic Mass | 261.05163 |
| SMILES | Cl.N=c1ccn2c(n1)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]12 |
| InChI | InChI=1S/C9H11N3O4.ClH/c10-5-1-2-12-8-7(16-9(12)11-5)6(14)4(3-13)15-8;/h1-2,4,6-8,10,13-14H,3H2;1H/t4-,6-,7+,8-;/m1./s1 |
| InChIKey | KZOWNALBTMILAP-JBMRGDGGSA-N |
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ancitabine hydrochloride (CHEBI:74843) has part ancitabine(1+) (CHEBI:74842) |
| ancitabine hydrochloride (CHEBI:74843) has role antimetabolite (CHEBI:35221) |
| ancitabine hydrochloride (CHEBI:74843) has role antineoplastic agent (CHEBI:35610) |
| ancitabine hydrochloride (CHEBI:74843) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (2R,3R,3aS,9aR)-2-(hydroxymethyl)-6-imino-2,3,3a,9a-tetrahydro-6H-furo[2',3':4,5][1,3]oxazolo[3,2-a]pyrimidin-3-ol hydrochloride |
| Synonyms | Source |
|---|---|
| 2,2'-anhydrocytidine hydrochloride | ChemIDplus |
| 2,2'-cyclocytidine hydrochloride | ChemIDplus |
| 2,2'-anhydroaracytidine hydrochloride | ChemIDplus |
| 2,2'-anhydro-1-β-D-arabinofuranosylcytosine hydrochloride | ChemIDplus |
| 2,2'-cyclocytidine monohydrochloride | ChemIDplus |
| 2,2'-anhydroarabinosylcytosine hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4166706 | Reaxys |
| CAS:10212-25-6 | ChemIDplus |
| CAS:10212-25-6 | KEGG COMPOUND |