EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N5O14P3 |
| Net Charge | +1 |
| Average Mass | 537.208 |
| Monoisotopic Mass | 537.00576 |
| SMILES | *OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2c[n+](C)c3c(=O)nc(N)nc32)[C@H](O)[C@@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methylguanosine 5'-triphosphate group (CHEBI:74655) is a organic cationic group (CHEBI:64769) |
| 7-methylguanosine 5'-triphosphate group (CHEBI:74655) is conjugate acid of 7-methylguanosine 5'-triphosphate(2−) group (CHEBI:74429) |
| 7-methylguanosine 5'-triphosphate group (CHEBI:74655) is substituent group from 7-methyl-GTP(1+) (CHEBI:50226) |
| Incoming Relation(s) |
| 7-methylguanosine 5'-triphosphate(2−) group (CHEBI:74429) is conjugate base of 7-methylguanosine 5'-triphosphate group (CHEBI:74655) |