EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N5O14P3 |
| Net Charge | -2 |
| Average Mass | 534.184 |
| Monoisotopic Mass | 533.98393 |
| SMILES | *OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2c[n+](C)c3c(=O)nc(N)nc32)[C@H](O)[C@@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methylguanosine 5'-triphosphate(2−) group (CHEBI:74429) is a organic anionic group (CHEBI:64775) |
| 7-methylguanosine 5'-triphosphate(2−) group (CHEBI:74429) is conjugate base of 7-methylguanosine 5'-triphosphate group (CHEBI:74655) |
| Incoming Relation(s) |
| 5'-(N7-methyl 5'-triphosphoguanosine)-(2'-O-methyl-purine-ribonucleotide)(2−) residue (CHEBI:133969) has functional parent 7-methylguanosine 5'-triphosphate(2−) group (CHEBI:74429) |
| 5'-(N7-methyl 5'-triphosphoguanosine)-(2'-O-methyl-ribonucleoside)(2−) residue (CHEBI:167609) has functional parent 7-methylguanosine 5'-triphosphate(2−) group (CHEBI:74429) |
| 5'-(N7-methyl 5'-triphosphoguanosine)-(purine-ribonucleotide)(2−) residue (CHEBI:133968) has functional parent 7-methylguanosine 5'-triphosphate(2−) group (CHEBI:74429) |
| 7-methylguanosine 5'-triphosphate group (CHEBI:74655) is conjugate acid of 7-methylguanosine 5'-triphosphate(2−) group (CHEBI:74429) |
| Synonyms | Source |
|---|---|
| 5'-(N7-methyl 5'-triphosphoguanosine) group | SUBMITTER |
| m7GpppX | SUBMITTER |
| UniProt Name | Source |
|---|---|
| N7-methylguanosine 5'-triphosphate group | UniProt |
| Citations |
|---|