EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N5O14P3 |
| Net Charge | +1 |
| Average Mass | 538.216 |
| Monoisotopic Mass | 538.01359 |
| SMILES | C[n+]1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c2nc(N)nc(=O)c21 |
| InChI | InChI=1S/C11H18N5O14P3/c1-15-3-16(8-5(15)9(19)14-11(12)13-8)10-7(18)6(17)4(28-10)2-27-32(23,24)30-33(25,26)29-31(20,21)22/h3-4,6-7,10,17-18H,2H2,1H3,(H6-,12,13,14,19,20,21,22,23,24,25,26)/p+1/t4-,6-,7-,10-/m1/s1 |
| InChIKey | DKVRNHPCAOHRSI-KQYNXXCUSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyl-GTP(1+) (CHEBI:50226) is a guanosine 5'-phosphate (CHEBI:37121) |
| 7-methyl-GTP(1+) (CHEBI:50226) is conjugate acid of 7-methyl-GTP (CHEBI:50210) |
| Incoming Relation(s) |
| N7-methyl-GpppA (CHEBI:157762) has functional parent 7-methyl-GTP(1+) (CHEBI:50226) |
| 7-methyl-GTP (CHEBI:50210) is conjugate base of 7-methyl-GTP(1+) (CHEBI:50226) |
| 7-methylguanosine 5'-triphosphate group (CHEBI:74655) is substituent group from 7-methyl-GTP(1+) (CHEBI:50226) |
| IUPAC Name |
|---|
| 7-methylguanosine 5'-(tetrahydrogen triphosphate) |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4081212 | Beilstein |