EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C84H164O6 |
| Net Charge | 0 |
| Average Mass | 1270.230 |
| Monoisotopic Mass | 1269.25279 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCC(C(=O)OCC(O)CO)C(O)CCCCCCCCCCCCCCC1CC1CCCCCCCCCCCCCCCCCC(=O)C(C)CCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C84H164O6/c1-4-6-8-10-12-14-16-18-20-22-23-24-26-30-34-41-47-53-59-65-71-81(84(89)90-76-80(86)75-85)83(88)73-67-61-55-49-43-37-36-40-46-52-58-64-70-79-74-78(79)69-63-57-51-45-39-33-29-27-31-35-42-48-54-60-66-72-82(87)77(3)68-62-56-50-44-38-32-28-25-21-19-17-15-13-11-9-7-5-2/h77-81,83,85-86,88H,4-76H2,1-3H3 |
| InChIKey | CAFCXJLNGZTNND-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycerol mono(keto-meromycolate) (CHEBI:74251) has functional parent glycerol (CHEBI:17754) |
| glycerol mono(keto-meromycolate) (CHEBI:74251) has functional parent keto-meromycolic acid (CHEBI:74248) |
| glycerol mono(keto-meromycolate) (CHEBI:74251) has role antigen (CHEBI:59132) |
| glycerol mono(keto-meromycolate) (CHEBI:74251) is a mycolate ester (CHEBI:74253) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl 2-{1-hydroxy-15-[2-(19-methyl-18-oxooctatriacontyl)cyclopropyl]pentadecyl}tetracosanoate |
| Citations |
|---|