EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C81H158O4 |
| Net Charge | 0 |
| Average Mass | 1196.151 |
| Monoisotopic Mass | 1195.21601 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCC(C(=O)O)C(O)CCCCCCCCCCCCCCC1CC1CCCCCCCCCCCCCCCCCC(=O)C(C)CCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C81H158O4/c1-4-6-8-10-12-14-16-18-20-22-23-24-26-30-34-41-47-53-59-65-71-78(81(84)85)80(83)73-67-61-55-49-43-37-36-40-46-52-58-64-70-77-74-76(77)69-63-57-51-45-39-33-29-27-31-35-42-48-54-60-66-72-79(82)75(3)68-62-56-50-44-38-32-28-25-21-19-17-15-13-11-9-7-5-2/h75-78,80,83H,4-74H2,1-3H3,(H,84,85) |
| InChIKey | UABNIVVXQNTSRT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-meromycolic acid (CHEBI:74248) has role antigen (CHEBI:59132) |
| keto-meromycolic acid (CHEBI:74248) is a mycolic acid (CHEBI:25438) |
| Incoming Relation(s) |
| C80 D-glucose mono(keto-meromycolate) (CHEBI:74255) has functional parent keto-meromycolic acid (CHEBI:74248) |
| glycerol mono(keto-meromycolate) (CHEBI:74251) has functional parent keto-meromycolic acid (CHEBI:74248) |
| IUPAC Name |
|---|
| 2-{1-hydroxy-15-[2-(19-methyl-18-oxooctatriacontyl)cyclopropyl]pentadecyl}tetracosanoic acid |
| Synonyms | Source |
|---|---|
| ketomeromycolic acid | ChEBI |
| keto meromycolic acid | ChEBI |
| Citations |
|---|