EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H35NO2 |
| Net Charge | 0 |
| Average Mass | 285.472 |
| Monoisotopic Mass | 285.26678 |
| SMILES | CCCCCCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C17H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(20)16(18)15-19/h13-14,16-17,19-20H,2-12,15,18H2,1H3/b14-13+/t16-,17+/m0/s1 |
| InChIKey | RBEJCQPPFCKTRZ-LHMZYYNSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C17 sphingosine (CHEBI:74220) is a aminodiol (CHEBI:22501) |
| C17 sphingosine (CHEBI:74220) is a sphingoid (CHEBI:35785) |
| C17 sphingosine (CHEBI:74220) is conjugate base of C17 sphingosine(1+) (CHEBI:74166) |
| Incoming Relation(s) |
| N-(docosanoyl)heptadecasphingosine-1-phosphocholine (CHEBI:136275) has functional parent C17 sphingosine (CHEBI:74220) |
| N-(tetracosenoyl)heptadecasphingosine-1-phosphocholine (CHEBI:136276) has functional parent C17 sphingosine (CHEBI:74220) |
| N-acylheptadecasphingosine (CHEBI:84445) has functional parent C17 sphingosine (CHEBI:74220) |
| C17 sphingosine(1+) (CHEBI:74166) is conjugate acid of C17 sphingosine (CHEBI:74220) |
| IUPAC Name |
|---|
| (2S,3R,4E)-2-aminoheptadec-4-ene-1,3-diol |
| Synonyms | Source |
|---|---|
| C17 sphing-4-enine | ChEBI |
| heptadecasphing-4-enine | ChEBI |
| heptadecasphingosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMSP01040002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18909638 | Reaxys |