EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N3O5 |
| Net Charge | 0 |
| Average Mass | 285.300 |
| Monoisotopic Mass | 285.13247 |
| SMILES | NCC(=O)N1CCC[C@H]1C(=O)N1CCC(O)[C@H]1C(=O)O |
| InChI | InChI=1S/C12H19N3O5/c13-6-9(17)14-4-1-2-7(14)11(18)15-5-3-8(16)10(15)12(19)20/h7-8,10,16H,1-6,13H2,(H,19,20)/t7-,8?,10-/m0/s1 |
| InChIKey | HVIBGVJOBJJPFB-OFQRNFBNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Pro-Hyp (CHEBI:74135) has functional parent L-proline (CHEBI:17203) |
| Gly-Pro-Hyp (CHEBI:74135) has functional parent 3-hydroxy-L-proline (CHEBI:20056) |
| Gly-Pro-Hyp (CHEBI:74135) has functional parent glycine (CHEBI:15428) |
| Gly-Pro-Hyp (CHEBI:74135) has role metabolite (CHEBI:25212) |
| Gly-Pro-Hyp (CHEBI:74135) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| glycyl-L-prolyl-3-hydroxy-L-proline |
| Synonyms | Source |
|---|---|
| Gly-L-Pro-L-Hyp | ChEBI |
| G-P-Hyp | ChEBI |
| GP-Hyp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002171 | HMDB |