EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@H]1NCCC1O |
| InChI | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3?,4-/m0/s1 |
| InChIKey | BJBUEDPLEOHJGE-BKLSDQPFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-L-proline (CHEBI:20056) is a L-proline derivative (CHEBI:84186) |
| 3-hydroxy-L-proline (CHEBI:20056) is a 3-hydroxyproline (CHEBI:64368) |
| 3-hydroxy-L-proline (CHEBI:20056) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| Gly-Pro-Hyp (CHEBI:74135) has functional parent 3-hydroxy-L-proline (CHEBI:20056) |
| cis-3-hydroxy-L-proline (CHEBI:55479) is a 3-hydroxy-L-proline (CHEBI:20056) |
| trans-3-hydroxy-L-proline (CHEBI:16889) is a 3-hydroxy-L-proline (CHEBI:20056) |
| 3-hydroxy-L-proline residue (CHEBI:141835) is substituent group from 3-hydroxy-L-proline (CHEBI:20056) |
| IUPAC Name |
|---|
| 3-hydroxy-L-proline |
| Synonym | Source |
|---|---|
| 3-Hydroxyproline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:567-36-2 | ChemIDplus |