EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O5 |
| Net Charge | 0 |
| Average Mass | 261.278 |
| Monoisotopic Mass | 261.13247 |
| SMILES | [NH3+]CCCC[C@H](NC(=O)[C@@H]([NH3+])CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H19N3O5/c11-4-2-1-3-7(10(17)18)13-9(16)6(12)5-8(14)15/h6-7H,1-5,11-12H2,(H,13,16)(H,14,15)(H,17,18)/t6-,7-/m0/s1 |
| InChIKey | OAMLVOVXNKILLQ-BQBZGAKWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Lys zwitterion (CHEBI:229953) is a dipeptide zwitterion (CHEBI:90799) |
| Asp-Lys zwitterion (CHEBI:229953) is tautomer of Asp-Lys (CHEBI:73829) |
| Incoming Relation(s) |
| Asp-Lys (CHEBI:73829) is tautomer of Asp-Lys zwitterion (CHEBI:229953) |
| IUPAC Name |
|---|
| (2S)-6-azaniumyl-2-{[(2S)-2-azaniumyl-3-carboxylatopropanoyl]amino}hexanoate |
| Synonyms | Source |
|---|---|
| L-Asp-L-Lys zwitterion | ChEBI |
| L-α-Asp-L-Lys zwitterion | ChEBI |
| L-aspartyl-L-lysine zwitterion | ChEBI |
| DK dipeptide zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-aspartyl-L-lysine | UniProt |
| Citations |
|---|