EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24GdN4O8 |
| Net Charge | -1 |
| Average Mass | 557.638 |
| Monoisotopic Mass | 558.08407 |
| SMILES | O=C([O-])C[N+]12CC[N+]3(CC(=O)[O-])CC[N+]4(CC(=O)[O-])CC[N+](CC(=O)[O-])(CC1)[Gd-]234 |
| InChI | InChI=1S/C16H28N4O8.Gd/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26;/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28);/q;+3/p-4 |
| InChIKey | GFSTXYOTEVLASN-UHFFFAOYSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gadoterate (CHEBI:73735) is a tetracarboxylic acid anion (CHEBI:35754) |
| gadoterate (CHEBI:73735) is conjugate base of gadoteric acid (CHEBI:73732) |
| Incoming Relation(s) |
| gadoterate meglumine (CHEBI:73727) has part gadoterate (CHEBI:73735) |
| gadoteric acid (CHEBI:73732) is conjugate acid of gadoterate (CHEBI:73735) |
| IUPAC Name |
|---|
| [2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-κ4N1,N4,N7,N10)tetraacetato(4−)]gadolinate(1−) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:16972779 | Reaxys |