EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25GdN4O8 |
| Net Charge | 0 |
| Average Mass | 558.646 |
| Monoisotopic Mass | 559.09134 |
| SMILES | O=C([O-])C[N+]12CC[N+]3(CC(=O)[O-])CC[N+]4(CC(=O)O)CC[N+](CC(=O)[O-])(CC1)[Gd-]234 |
| InChI | InChI=1S/C16H28N4O8.Gd/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26;/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28);/q;+3/p-3 |
| InChIKey | GFSTXYOTEVLASN-UHFFFAOYSA-K |
| Wikipedia |
|---|
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gadoteric acid (CHEBI:73732) has role MRI contrast agent (CHEBI:37335) |
| gadoteric acid (CHEBI:73732) is a gadolinium coordination entity (CHEBI:35730) |
| gadoteric acid (CHEBI:73732) is conjugate acid of gadoterate (CHEBI:73735) |
| Incoming Relation(s) |
| gadoterate (CHEBI:73735) is conjugate base of gadoteric acid (CHEBI:73732) |
| IUPAC Name |
|---|
| [2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-κ4N1,N4,N7,N10)tetraacetato(3−)]gadolinium |
| INNs | Source |
|---|---|
| acide gadoterique | WHO MedNet |
| acido gadoterico | WHO MedNet |
| gadoteric acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Artirem | ChEMBL |
| DOTA-Gd | ChEBI |
| Gadoterate | ChEMBL |
| Gd-DOTA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D08007 | KEGG DRUG |
| Gadoteric_acid | Wikipedia |
| WO2005070400 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:17968462 | Reaxys |
| CAS:72573-82-1 | ChemIDplus |
| CAS:72573-82-1 | KEGG DRUG |
| Citations |
|---|