EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25GdN4O8.C7H17NO5 |
| Net Charge | 0 |
| Average Mass | 753.861 |
| Monoisotopic Mass | 754.20202 |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C([O-])C[N+]12CC[N+]3(CC(=O)[O-])CC[N+]4(CC(=O)O)CC[N+](CC(=O)[O-])(CC1)[Gd-]234 |
| InChI | InChI=1S/C16H28N4O8.C7H17NO5.Gd/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26;1-8-2-4(10)6(12)7(13)5(11)3-9;/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28);4-13H,2-3H2,1H3;/q;;+3/p-3/t;4-,5+,6+,7+;/m.0./s1 |
| InChIKey | RYHQMKVRYNEBNJ-BMWGJIJESA-K |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gadoterate meglumine (CHEBI:73727) has part gadoterate (CHEBI:73735) |
| gadoterate meglumine (CHEBI:73727) has role antineoplastic agent (CHEBI:35610) |
| gadoterate meglumine (CHEBI:73727) has role MRI contrast agent (CHEBI:37335) |
| gadoterate meglumine (CHEBI:73727) is a gadolinium coordination entity (CHEBI:35730) |
| gadoterate meglumine (CHEBI:73727) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| 1-deoxy-1-(methylazaniumyl)-D-glucitol [2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-κ4N1,N4,N7,N10)tetraacetato(4−)]gadolinate(1−) |
| [2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-κ4N1,N4,N7,N10)tetraacetato(3−)]gadolinium—1-deoxy-1-(methylamino)-D-glucitol (1/1) |
| Synonyms | Source |
|---|---|
| Gadolinium-DOTA meglumine | ChemIDplus |
| Gadoterate meglumine | ChEMBL |
| Gd-DOTA meglumine | ChemIDplus |
| Magnescope | ChEMBL |
| Meglumine gadopentate | KEGG DRUG |
| Meglumine gadoterate | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Dotarem | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D03355 | KEGG DRUG |
| Gadoteric_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:92943-93-6 | KEGG DRUG |
| CAS:92943-93-6 | ChemIDplus |
| Citations |
|---|