EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30NO5 |
| Net Charge | +1 |
| Average Mass | 352.451 |
| Monoisotopic Mass | 352.21185 |
| SMILES | C[NH2+]CC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H29NO5/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6/h8-10,13,20-21H,11H2,1-7H3/p+1 |
| InChIKey | OCUJLLGVOUDECM-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipivefrin(1+) (CHEBI:73714) is a ammonium ion derivative (CHEBI:35274) |
| dipivefrin(1+) (CHEBI:73714) is conjugate acid of dipivefrin (CHEBI:4646) |
| Incoming Relation(s) |
| dipivefrin hydrochloride (CHEBI:4647) has part dipivefrin(1+) (CHEBI:73714) |
| dipivefrin (CHEBI:4646) is conjugate base of dipivefrin(1+) (CHEBI:73714) |
| IUPAC Name |
|---|
| 2-{3,4-bis[(2,2-dimethylpropanoyl)oxy]phenyl}-2-hydroxy-N-methylethanaminium |