EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4647 - dipivefrin hydrochloride
| Formula | C19H29NO5.HCl |
| Net Charge | 0 |
| Average Mass | 387.904 |
| Monoisotopic Mass | 387.18125 |
| SMILES | CNCC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C19H29NO5.ClH/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6;/h8-10,13,20-21H,11H2,1-7H3;1H |
| InChIKey | VKFAUCPBMAGVRG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. |
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipivefrin hydrochloride (CHEBI:4647) has part dipivefrin(1+) (CHEBI:73714) |
| dipivefrin hydrochloride (CHEBI:4647) has role adrenergic agonist (CHEBI:37886) |
| dipivefrin hydrochloride (CHEBI:4647) has role antiglaucoma drug (CHEBI:39456) |
| dipivefrin hydrochloride (CHEBI:4647) has role sympathomimetic agent (CHEBI:35524) |
| dipivefrin hydrochloride (CHEBI:4647) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-{3,4-bis[(2,2-dimethylpropanoyl)oxy]phenyl}-2-hydroxy-N-methylethanaminium chloride |
| Synonyms | Source |
|---|---|
| 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) hydrochloride | IUPAC |
| dipivefrin HCl | ChemIDplus |
| 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol hydrochloride | ChEBI |
| dipivefrine HCl | ChEBI |
| dipivefrine hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6458483 | Beilstein |
| CAS:64019-93-8 | KEGG DRUG |
| CAS:64019-93-8 | ChemIDplus |