EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4646 - dipivefrin
| Formula | C19H29NO5 |
| Net Charge | 0 |
| Average Mass | 351.443 |
| Monoisotopic Mass | 351.20457 |
| SMILES | CNCC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H29NO5/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6/h8-10,13,20-21H,11H2,1-7H3 |
| InChIKey | OCUJLLGVOUDECM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. |
| Applications: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. adrenergic agonist An agent that selectively binds to and activates adrenergic receptors. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipivefrin (CHEBI:4646) has functional parent adrenaline (CHEBI:33568) |
| dipivefrin (CHEBI:4646) has role adrenergic agonist (CHEBI:37886) |
| dipivefrin (CHEBI:4646) has role antiglaucoma drug (CHEBI:39456) |
| dipivefrin (CHEBI:4646) has role ophthalmology drug (CHEBI:66981) |
| dipivefrin (CHEBI:4646) has role prodrug (CHEBI:50266) |
| dipivefrin (CHEBI:4646) has role sympathomimetic agent (CHEBI:35524) |
| dipivefrin (CHEBI:4646) is a ethanolamines (CHEBI:23981) |
| dipivefrin (CHEBI:4646) is a pivalate ester (CHEBI:50784) |
| dipivefrin (CHEBI:4646) is conjugate base of dipivefrin(1+) (CHEBI:73714) |
| Incoming Relation(s) |
| dipivefrin(1+) (CHEBI:73714) is conjugate acid of dipivefrin (CHEBI:4646) |
| IUPAC Name |
|---|
| 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) |
| INNs | Source |
|---|---|
| dipivefrine | ChEBI |
| dipivefrina | ChemIDplus |
| dipivefrinum | ChemIDplus |
| dipivéfrine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Dipivefrin | KEGG COMPOUND |
| Dipivefrine | KEGG COMPOUND |
| dipivalyl epinephrine | ChEBI |
| (±)-4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate | ChEBI |
| 4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate | ChEBI |
| 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol | ChEBI |