EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O6 |
| Net Charge | 0 |
| Average Mass | 275.261 |
| Monoisotopic Mass | 275.11174 |
| SMILES | NC(=O)CC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6/c11-5(9(16)17)1-4-8(15)13-6(10(18)19)2-3-7(12)14/h5-6H,1-4,11H2,(H2,12,14)(H,13,15)(H,16,17)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | JBFYFLXEJFQWMU-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (7595563) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Gln (CHEBI:73707) has functional parent L-glutamic acid (CHEBI:16015) |
| γ-Glu-Gln (CHEBI:73707) has functional parent L-glutamine (CHEBI:18050) |
| γ-Glu-Gln (CHEBI:73707) has role human metabolite (CHEBI:77746) |
| γ-Glu-Gln (CHEBI:73707) is a dipeptide (CHEBI:46761) |
| γ-Glu-Gln (CHEBI:73707) is conjugate acid of γ-Glu-Gln(1−) (CHEBI:133625) |
| Incoming Relation(s) |
| γ-Glu-Gln(1−) (CHEBI:133625) is conjugate base of γ-Glu-Gln (CHEBI:73707) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-glutamine |
| Synonym | Source |
|---|---|
| γ-L-Glu-L-Gln | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011738 | HMDB |
| C05283 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729785 | Reaxys |
| CAS:1466-50-8 | ChemIDplus |
| Citations |
|---|