EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N3O6 |
| Net Charge | -1 |
| Average Mass | 274.253 |
| Monoisotopic Mass | 274.10446 |
| SMILES | NC(=O)CC[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H17N3O6/c11-5(9(16)17)1-4-8(15)13-6(10(18)19)2-3-7(12)14/h5-6H,1-4,11H2,(H2,12,14)(H,13,15)(H,16,17)(H,18,19)/p-1/t5-,6-/m0/s1 |
| InChIKey | JBFYFLXEJFQWMU-WDSKDSINSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Gln(1−) (CHEBI:133625) has role human metabolite (CHEBI:77746) |
| γ-Glu-Gln(1−) (CHEBI:133625) is a peptide anion (CHEBI:60334) |
| γ-Glu-Gln(1−) (CHEBI:133625) is conjugate base of γ-Glu-Gln (CHEBI:73707) |
| Incoming Relation(s) |
| γ-Glu-Gln (CHEBI:73707) is conjugate acid of γ-Glu-Gln(1−) (CHEBI:133625) |
| IUPAC Name |
|---|
| (2S)-5-amino-2-{[(4S)-4-azaniumyl-4-carboxylatobutanoyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| γ-glutamylglutaminate | ChEBI |
| L-γ-Glu-L-Glu(1−) | ChEBI |
| L-γ-glutamyl-L-glutaminate | ChEBI |